C18H14FN3O5S — CID 8873298
2-(5-fluoro-2-nitrophenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 8873298) has the molecular formula C18H14FN3O5S and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5-fluoro-2-nitrophenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8873298 |
| Molecular Formula | C18H14FN3O5S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)COc3cc(F)ccc3[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C18H14FN3O5S/c1-26-13-5-2-11(3-6-13)14-10-28-18(20-14)21-17(23)9-27-16-8-12(19)4-7-15(16)22(24)25/h2-8,10H,9H2,1H3,(H,20,21,23) |
| InChIKey | AAAARVRWLZPHBA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|