C17H15FN2O3S — CID 60550069
4-(2-fluorophenoxy)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 60550069) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 60550069 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCCOc1ccccc1F)Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C17H15FN2O3S/c18-12-5-1-2-6-14(12)22-10-4-8-16(21)20-17-19-13(11-24-17)15-7-3-9-23-15/h1-3,5-7,9,11H,4,8,10H2,(H,19,20,21) |
| InChIKey | WLPDIMCDVQHVJV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|