C24H19N5O4S2 — CID 23745940
3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23745940) has the molecular formula C24H19N5O4S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23745940 |
| Molecular Formula | C24H19N5O4S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)CCSc2nnc(-c3ccco3)c(-c3ccco3)n2)n1 |
| InChI | InChI=1S/C24H19N5O4S2/c1-31-17-7-3-2-6-15(17)16-14-35-23(25-16)26-20(30)10-13-34-24-27-21(18-8-4-11-32-18)22(28-29-24)19-9-5-12-33-19/h2-9,11-12,14H,10,13H2,1H3,(H,25,26,30) |
| InChIKey | JPOOFKFQWHQPOU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|