C16H15N3O4S — CID 6401510
ethyl 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]propanoate (PubChem CID 6401510) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]propanoate.
| Compound Name | ethyl 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 6401510 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | ethyl 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]propanoate |
| SMILES | CCOC(=O)CCSc1nnc(-c2ccco2)c(-c2ccco2)n1 |
| InChI | InChI=1S/C16H15N3O4S/c1-2-21-13(20)7-10-24-16-17-14(11-5-3-8-22-11)15(18-19-16)12-6-4-9-23-12/h3-6,8-9H,2,7,10H2,1H3 |
| InChIKey | VEBYYIMCPGNPBR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|