C18H13N3O2S — CID 2940938
3-benzylsulfanyl-5,6-bis(furan-2-yl)-1,2,4-triazine (PubChem CID 2940938) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-benzylsulfanyl-5,6-bis(furan-2-yl)-1,2,4-triazine.
| Compound Name | 3-benzylsulfanyl-5,6-bis(furan-2-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 2940938 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-benzylsulfanyl-5,6-bis(furan-2-yl)-1,2,4-triazine |
| SMILES | c1ccc(CSc2nnc(-c3ccco3)c(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C18H13N3O2S/c1-2-6-13(7-3-1)12-24-18-19-16(14-8-4-10-22-14)17(20-21-18)15-9-5-11-23-15/h1-11H,12H2 |
| InChIKey | QKTJLQPSNJEMRD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|