About 2-benzylsulfanylfuran
2-benzylsulfanylfuran (PubChem CID 12535616) has the molecular formula C11H10OS
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-benzylsulfanylfuran.
Molecular Properties
| Compound Name | 2-benzylsulfanylfuran |
| PubChem CID | 12535616 |
| Molecular Formula | C11H10OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-benzylsulfanylfuran |
| SMILES | c1ccc(CSc2ccco2)cc1 |
| InChI | InChI=1S/C11H10OS/c1-2-5-10(6-3-1)9-13-11-7-4-8-12-11/h1-8H,9H2 |
| InChIKey | UORYTEXWAFYKDG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylsulfanylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanylfuran?
The IUPAC name of 2-benzylsulfanylfuran (CID 12535616) is 2-benzylsulfanylfuran.
What is the SMILES notation for 2-benzylsulfanylfuran?
The canonical SMILES for 2-benzylsulfanylfuran is c1ccc(CSc2ccco2)cc1.
What is the InChIKey of 2-benzylsulfanylfuran?
The InChIKey is UORYTEXWAFYKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10OS/c1-2-5-10(6-3-1)9-13-11-7-4-8-12-11/h1-8H,9H2.
What are the key properties of 2-benzylsulfanylfuran?
2-benzylsulfanylfuran has a molecular weight of 190.27 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanylfuran is sourced from PubChem (CID 12535616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).