C17H11N3O3S2 — CID 6486830
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-thiophen-2-ylethanone (PubChem CID 6486830) has the molecular formula C17H11N3O3S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 6486830 |
| Molecular Formula | C17H11N3O3S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-thiophen-2-ylethanone |
| SMILES | O=C(CSc1nnc(-c2ccco2)c(-c2ccco2)n1)c1cccs1 |
| InChI | InChI=1S/C17H11N3O3S2/c21-11(14-6-3-9-24-14)10-25-17-18-15(12-4-1-7-22-12)16(19-20-17)13-5-2-8-23-13/h1-9H,10H2 |
| InChIKey | YFKOXUGKMRXATQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|