C21H17N3O5S — CID 6404288
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(2,5-dimethoxyphenyl)ethanone (PubChem CID 6404288) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(2,5-dimethoxyphenyl)ethanone.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(2,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 6404288 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(2,5-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(OC)c(C(=O)CSc2nnc(-c3ccco3)c(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C21H17N3O5S/c1-26-13-7-8-16(27-2)14(11-13)15(25)12-30-21-22-19(17-5-3-9-28-17)20(23-24-21)18-6-4-10-29-18/h3-11H,12H2,1-2H3 |
| InChIKey | VHBILFKKZGIEEQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|