C21H17ClN4O5S — CID 6403399
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 6403399) has the molecular formula C21H17ClN4O5S and a molecular weight of 472.91 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6403399 |
| Molecular Formula | C21H17ClN4O5S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CSc2nnc(-c3ccco3)c(-c3ccco3)n2)cc1Cl |
| InChI | InChI=1S/C21H17ClN4O5S/c1-28-16-10-17(29-2)13(9-12(16)22)23-18(27)11-32-21-24-19(14-5-3-7-30-14)20(25-26-21)15-6-4-8-31-15/h3-10H,11H2,1-2H3,(H,23,27) |
| InChIKey | SPNGUHNQYQAWRL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|