C19H13N5O6S — CID 169174710
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-hydroxy-4-nitrophenyl)acetamide (PubChem CID 169174710) has the molecular formula C19H13N5O6S and a molecular weight of 439.41 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-hydroxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 169174710 |
| Molecular Formula | C19H13N5O6S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C19H13N5O6S/c25-13-9-11(24(27)28)5-6-12(13)20-16(26)10-31-19-21-17(14-3-1-7-29-14)18(22-23-19)15-4-2-8-30-15/h1-9,25H,10H2,(H,20,26) |
| InChIKey | HXZDEPQUSOFBBE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|