C20H14N4O5S — CID 6402772
N-(1,3-benzodioxol-5-yl)-2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetamide (PubChem CID 6402772) has the molecular formula C20H14N4O5S and a molecular weight of 422.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6402772 |
| Molecular Formula | C20H14N4O5S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14N4O5S/c25-17(21-12-5-6-13-16(9-12)29-11-28-13)10-30-20-22-18(14-3-1-7-26-14)19(23-24-20)15-4-2-8-27-15/h1-9H,10-11H2,(H,21,25) |
| InChIKey | GGECTXZHMNAOBI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|