C20H15N5O6S — CID 2941083
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 2941083) has the molecular formula C20H15N5O6S and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2941083 |
| Molecular Formula | C20H15N5O6S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(-c2ccco2)c(-c2ccco2)n1 |
| InChI | InChI=1S/C20H15N5O6S/c1-29-16-10-12(25(27)28)6-7-13(16)21-17(26)11-32-20-22-18(14-4-2-8-30-14)19(23-24-20)15-5-3-9-31-15/h2-10H,11H2,1H3,(H,21,26) |
| InChIKey | ZKZUFQLXRBUEBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 146.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|