C17H18N6O4S — CID 55737705
N-(2-methoxy-4-nitrophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 55737705) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55737705 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nc2nc(C)c(C)c(C)n2n1 |
| InChI | InChI=1S/C17H18N6O4S/c1-9-10(2)18-16-20-17(21-22(16)11(9)3)28-8-15(24)19-13-6-5-12(23(25)26)7-14(13)27-4/h5-7H,8H2,1-4H3,(H,19,24) |
| InChIKey | DDFPSRIMLQOPLG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|