C18H15N3O4S — CID 3539327
N-(2-methoxy-4-nitrophenyl)-2-quinolin-8-ylsulfanylacetamide (PubChem CID 3539327) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-quinolin-8-ylsulfanylacetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-quinolin-8-ylsulfanylacetamide |
|---|---|
| PubChem CID | 3539327 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-quinolin-8-ylsulfanylacetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1cccc2cccnc12 |
| InChI | InChI=1S/C18H15N3O4S/c1-25-15-10-13(21(23)24)7-8-14(15)20-17(22)11-26-16-6-2-4-12-5-3-9-19-18(12)16/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | BLRTYDHJGGRIQC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|