C14H15N5O4S — CID 16961494
2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 16961494) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16961494 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1n[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C14H15N5O4S/c1-23-11-6-9(19(21)22)4-5-10(11)15-12(20)7-24-14-16-13(17-18-14)8-2-3-8/h4-6,8H,2-3,7H2,1H3,(H,15,20)(H,16,17,18) |
| InChIKey | YASRMGDHJAQIRB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|