C17H14FN5O4S — CID 7398909
2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 7398909) has the molecular formula C17H14FN5O4S and a molecular weight of 403.40 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7398909 |
| Molecular Formula | C17H14FN5O4S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C17H14FN5O4S/c1-27-14-8-10(23(25)26)6-7-13(14)19-15(24)9-28-17-20-16(21-22-17)11-4-2-3-5-12(11)18/h2-8H,9H2,1H3,(H,19,24)(H,20,21,22) |
| InChIKey | LVFJOEUPELEBDF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|