C11H10N4O5S — CID 71554854
2-[[5-(2-methoxy-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 71554854) has the molecular formula C11H10N4O5S and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-[[5-(2-methoxy-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(2-methoxy-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 71554854 |
| Molecular Formula | C11H10N4O5S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[[5-(2-methoxy-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1nc(SCC(=O)O)n[nH]1 |
| InChI | InChI=1S/C11H10N4O5S/c1-20-8-4-6(15(18)19)2-3-7(8)10-12-11(14-13-10)21-5-9(16)17/h2-4H,5H2,1H3,(H,16,17)(H,12,13,14) |
| InChIKey | GLLVUYABAPKZJJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|