C17H16N4O4S — CID 48837560
5-(2,4-dimethoxyphenyl)-3-[(3-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole (PubChem CID 48837560) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3-[(3-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(2,4-dimethoxyphenyl)-3-[(3-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 48837560 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3-[(3-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
| SMILES | COc1ccc(-c2nc(SCc3cccc([N+](=O)[O-])c3)n[nH]2)c(OC)c1 |
| InChI | InChI=1S/C17H16N4O4S/c1-24-13-6-7-14(15(9-13)25-2)16-18-17(20-19-16)26-10-11-4-3-5-12(8-11)21(22)23/h3-9H,10H2,1-2H3,(H,18,19,20) |
| InChIKey | KSVBDWQTTROFPY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|