C14H21N3O2SSi — CID 56529711
[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane (PubChem CID 56529711) has the molecular formula C14H21N3O2SSi and a molecular weight of 323.49 g/mol. Its IUPAC name is [5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane.
| Compound Name | [5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane |
|---|---|
| PubChem CID | 56529711 |
| Molecular Formula | C14H21N3O2SSi |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane |
| SMILES | COc1ccc(-c2nc(SC[Si](C)(C)C)n[nH]2)c(OC)c1 |
| InChI | InChI=1S/C14H21N3O2SSi/c1-18-10-6-7-11(12(8-10)19-2)13-15-14(17-16-13)20-9-21(3,4)5/h6-8H,9H2,1-5H3,(H,15,16,17) |
| InChIKey | HLHOMOWUQHBFQY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|