C17H16N4O3S — CID 8986062
5-(4-methoxyphenyl)-3-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-1H-1,2,4-triazole (PubChem CID 8986062) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-(4-methoxyphenyl)-3-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 8986062 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-1H-1,2,4-triazole |
| SMILES | COc1ccc(-c2nc(S[C@H](C)c3cccc([N+](=O)[O-])c3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-11(13-4-3-5-14(10-13)21(22)23)25-17-18-16(19-20-17)12-6-8-15(24-2)9-7-12/h3-11H,1-2H3,(H,18,19,20)/t11-/m1/s1 |
| InChIKey | CQYXHSFHTKDXCH-LLVKDONJSA-N |
| XLogP | 4.24 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|