C18H17N3O5S — CID 18092321
2-(2,4-dimethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole (PubChem CID 18092321) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dimethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18092321 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(SC(C)c3cccc([N+](=O)[O-])c3)o2)c(OC)c1 |
| InChI | InChI=1S/C18H17N3O5S/c1-11(12-5-4-6-13(9-12)21(22)23)27-18-20-19-17(26-18)15-8-7-14(24-2)10-16(15)25-3/h4-11H,1-3H3 |
| InChIKey | RYLJGTLIBCOXFP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|