C21H23N3O4S — CID 90155725
2-[4-(1-methoxyethyl)-2-methylphenyl]-5-[1-(3-nitrophenyl)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 90155725) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[4-(1-methoxyethyl)-2-methylphenyl]-5-[1-(3-nitrophenyl)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-(1-methoxyethyl)-2-methylphenyl]-5-[1-(3-nitrophenyl)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90155725 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[4-(1-methoxyethyl)-2-methylphenyl]-5-[1-(3-nitrophenyl)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | CCC(Sc1nnc(-c2ccc(C(C)OC)cc2C)o1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-5-19(16-7-6-8-17(12-16)24(25)26)29-21-23-22-20(28-21)18-10-9-15(11-13(18)2)14(3)27-4/h6-12,14,19H,5H2,1-4H3 |
| InChIKey | FRVQNKTYKCTFMV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|