C15H14N4O3S2 — CID 46531374
2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole (PubChem CID 46531374) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46531374 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SC(C)c3cccc([N+](=O)[O-])c3)o2)s1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-8-13(24-10(3)16-8)14-17-18-15(22-14)23-9(2)11-5-4-6-12(7-11)19(20)21/h4-7,9H,1-3H3 |
| InChIKey | ZKFABXZOYWYSNU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|