C11H11N3O2S3 — CID 25439389
2-methylsulfanyl-5-[(1S)-1-(3-nitrophenyl)ethyl]sulfanyl-1,3,4-thiadiazole (PubChem CID 25439389) has the molecular formula C11H11N3O2S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-methylsulfanyl-5-[(1S)-1-(3-nitrophenyl)ethyl]sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-methylsulfanyl-5-[(1S)-1-(3-nitrophenyl)ethyl]sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 25439389 |
| Molecular Formula | C11H11N3O2S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 2-methylsulfanyl-5-[(1S)-1-(3-nitrophenyl)ethyl]sulfanyl-1,3,4-thiadiazole |
| SMILES | CSc1nnc(S[C@@H](C)c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C11H11N3O2S3/c1-7(18-11-13-12-10(17-2)19-11)8-4-3-5-9(6-8)14(15)16/h3-7H,1-2H3/t7-/m0/s1 |
| InChIKey | UWFMSSQYTSSMMY-ZETCQYMHSA-N |
| XLogP | 4.02 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|