C11H12N4O2S — CID 17422817
4-methyl-3-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole (PubChem CID 17422817) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-methyl-3-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-methyl-3-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 17422817 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-methyl-3-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole |
| SMILES | CC(Sc1nncn1C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N4O2S/c1-8(18-11-13-12-7-14(11)2)9-4-3-5-10(6-9)15(16)17/h3-8H,1-2H3 |
| InChIKey | DJQFGUCQTBAJMM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|