C20H18N4O3S — CID 16960574
8-methoxy-5-methyl-1-[1-(3-nitrophenyl)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 16960574) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 8-methoxy-5-methyl-1-[1-(3-nitrophenyl)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 8-methoxy-5-methyl-1-[1-(3-nitrophenyl)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 16960574 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 8-methoxy-5-methyl-1-[1-(3-nitrophenyl)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | COc1ccc2c(C)cc3nnc(SC(C)c4cccc([N+](=O)[O-])c4)n3c2c1 |
| InChI | InChI=1S/C20H18N4O3S/c1-12-9-19-21-22-20(23(19)18-11-16(27-3)7-8-17(12)18)28-13(2)14-5-4-6-15(10-14)24(25)26/h4-11,13H,1-3H3 |
| InChIKey | AQDNJWPZBBVIMN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|