C18H16N2O5S — CID 9067351
S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 3-methoxybenzenecarbothioate (PubChem CID 9067351) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 3-methoxybenzenecarbothioate.
| Compound Name | S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 3-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 9067351 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 3-methoxybenzenecarbothioate |
| SMILES | COc1cccc(C(=O)Sc2nnc(-c3ccc(OC)cc3OC)o2)c1 |
| InChI | InChI=1S/C18H16N2O5S/c1-22-12-6-4-5-11(9-12)17(21)26-18-20-19-16(25-18)14-8-7-13(23-2)10-15(14)24-3/h4-10H,1-3H3 |
| InChIKey | DSOKWMYBRDGALS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|