C18H16N2O4S — CID 9067347
S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-phenylethanethioate (PubChem CID 9067347) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-phenylethanethioate.
| Compound Name | S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-phenylethanethioate |
|---|---|
| PubChem CID | 9067347 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | S-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-phenylethanethioate |
| SMILES | COc1ccc(-c2nnc(SC(=O)Cc3ccccc3)o2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-22-13-8-9-14(15(11-13)23-2)17-19-20-18(24-17)25-16(21)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | IHAKJBWMAMGEMV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|