C22H19N3OS — CID 7906363
3-benzhydrylsulfanyl-5-(4-methoxyphenyl)-1H-1,2,4-triazole (PubChem CID 7906363) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-benzhydrylsulfanyl-5-(4-methoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 3-benzhydrylsulfanyl-5-(4-methoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 7906363 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-benzhydrylsulfanyl-5-(4-methoxyphenyl)-1H-1,2,4-triazole |
| SMILES | COc1ccc(-c2nc(SC(c3ccccc3)c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C22H19N3OS/c1-26-19-14-12-18(13-15-19)21-23-22(25-24-21)27-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,20H,1H3,(H,23,24,25) |
| InChIKey | VBMLHLBYDOJOLT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |