C18H14N6O3S — CID 7715395
2-(4-nitrophenyl)-5-[(1S)-1-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,4-oxadiazole (PubChem CID 7715395) has the molecular formula C18H14N6O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[(1S)-1-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-nitrophenyl)-5-[(1S)-1-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7715395 |
| Molecular Formula | C18H14N6O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[(1S)-1-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,4-oxadiazole |
| SMILES | C[C@H](Sc1n[nH]c(-c2ccccc2)n1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H14N6O3S/c1-11(28-18-19-15(20-23-18)12-5-3-2-4-6-12)16-21-22-17(27-16)13-7-9-14(10-8-13)24(25)26/h2-11H,1H3,(H,19,20,23)/t11-/m0/s1 |
| InChIKey | KNBHDTJLBUKZRA-NSHDSACASA-N |
| XLogP | 4.28 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|