C24H24N6O3S — CID 25443054
2-[(1S)-1-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 25443054) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[(1S)-1-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(1S)-1-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 25443054 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[(1S)-1-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | C[C@H](Sc1nc(C2CCCCC2)n(-c2ccccc2)n1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C24H24N6O3S/c1-16(22-26-27-23(33-22)18-12-14-20(15-13-18)30(31)32)34-24-25-21(17-8-4-2-5-9-17)29(28-24)19-10-6-3-7-11-19/h3,6-7,10-17H,2,4-5,8-9H2,1H3/t16-/m0/s1 |
| InChIKey | KZQSVRBKQYMIDW-INIZCTEOSA-N |
| XLogP | 6.13 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|