C16H15Cl2N5OS — CID 55737730
N-(2,3-dichlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 55737730) has the molecular formula C16H15Cl2N5OS and a molecular weight of 396.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55737730 |
| Molecular Formula | C16H15Cl2N5OS |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nc2nc(SCC(=O)Nc3cccc(Cl)c3Cl)nn2c(C)c1C |
| InChI | InChI=1S/C16H15Cl2N5OS/c1-8-9(2)19-15-21-16(22-23(15)10(8)3)25-7-13(24)20-12-6-4-5-11(17)14(12)18/h4-6H,7H2,1-3H3,(H,20,24) |
| InChIKey | LBDQUFZXGIKVIN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |