C24H17Cl2N3OS — CID 3256970
N-(2,3-dichlorophenyl)-2-(4,6-diphenylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 3256970) has the molecular formula C24H17Cl2N3OS and a molecular weight of 466.39 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(4,6-diphenylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(4,6-diphenylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3256970 |
| Molecular Formula | C24H17Cl2N3OS |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(4,6-diphenylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cc(-c2ccccc2)n1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl2N3OS/c25-18-12-7-13-19(23(18)26)27-22(30)15-31-24-28-20(16-8-3-1-4-9-16)14-21(29-24)17-10-5-2-6-11-17/h1-14H,15H2,(H,27,30) |
| InChIKey | KMILIVQWFCYIOL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |