C17H15F3N6O3S — CID 60519668
N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 60519668) has the molecular formula C17H15F3N6O3S and a molecular weight of 440.41 g/mol. Its IUPAC name is N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 60519668 |
| Molecular Formula | C17H15F3N6O3S |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nc2nc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C(F)(F)F)nn2c(C)c1C |
| InChI | InChI=1S/C17H15F3N6O3S/c1-8-9(2)21-15-23-16(24-25(15)10(8)3)30-7-14(27)22-13-5-4-11(26(28)29)6-12(13)17(18,19)20/h4-6H,7H2,1-3H3,(H,22,27) |
| InChIKey | FFBFFZHNZHRLTL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|