C14H14F3N5O4S — CID 55324809
N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 55324809) has the molecular formula C14H14F3N5O4S and a molecular weight of 405.36 g/mol. Its IUPAC name is N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55324809 |
| Molecular Formula | C14H14F3N5O4S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[4-nitro-2-(trifluoromethyl)phenyl]-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)n[nH]c1=O |
| InChI | InChI=1S/C14H14F3N5O4S/c1-2-5-21-12(24)19-20-13(21)27-7-11(23)18-10-4-3-8(22(25)26)6-9(10)14(15,16)17/h3-4,6H,2,5,7H2,1H3,(H,18,23)(H,19,24) |
| InChIKey | GHQRQEXWZJJOSI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|