C14H17N5O5S — CID 4008251
N-(4-methoxy-2-nitrophenyl)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4008251) has the molecular formula C14H17N5O5S and a molecular weight of 367.39 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4008251 |
| Molecular Formula | C14H17N5O5S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C14H17N5O5S/c1-3-6-18-13(21)16-17-14(18)25-8-12(20)15-10-5-4-9(24-2)7-11(10)19(22)23/h4-5,7H,3,6,8H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | SCEMLQMEDZMNJP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|