C15H19N5O5S — CID 28947113
2-[[5-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 28947113) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[[5-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 28947113 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[[5-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(C[C@H](C)O)n2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N5O5S/c1-9(21)6-13-17-18-15(19(13)2)26-8-14(22)16-11-5-4-10(25-3)7-12(11)20(23)24/h4-5,7,9,21H,6,8H2,1-3H3,(H,16,22)/t9-/m0/s1 |
| InChIKey | VAXDDOGXGYSAQH-VIFPVBQESA-N |
| XLogP | 1.39 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|