C14H17N5O4S — CID 3636584
N-(4-methoxy-2-nitrophenyl)-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 3636584) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3636584 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2n[nH]c(C(C)C)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17N5O4S/c1-8(2)13-16-14(18-17-13)24-7-12(20)15-10-5-4-9(23-3)6-11(10)19(21)22/h4-6,8H,7H2,1-3H3,(H,15,20)(H,16,17,18) |
| InChIKey | LNPYFWSNRQFUAG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|