C16H17N5O6S — CID 31661678
ethyl 4-amino-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 31661678) has the molecular formula C16H17N5O6S and a molecular weight of 407.41 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 31661678 |
| Molecular Formula | C16H17N5O6S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 4-amino-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])nc1N |
| InChI | InChI=1S/C16H17N5O6S/c1-3-27-15(23)10-7-18-16(20-14(10)17)28-8-13(22)19-11-5-4-9(26-2)6-12(11)21(24)25/h4-7H,3,8H2,1-2H3,(H,19,22)(H2,17,18,20) |
| InChIKey | XYAHVPQCMXTTGX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|