C19H23N5O5S — CID 3168419
ethyl 4-amino-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 3168419) has the molecular formula C19H23N5O5S and a molecular weight of 433.49 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3168419 |
| Molecular Formula | C19H23N5O5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | ethyl 4-amino-2-[2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)NNC(=O)COc2ccc(CC)cc2)nc1N |
| InChI | InChI=1S/C19H23N5O5S/c1-3-12-5-7-13(8-6-12)29-10-15(25)23-24-16(26)11-30-19-21-9-14(17(20)22-19)18(27)28-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,23,25)(H,24,26)(H2,20,21,22) |
| InChIKey | XVICFEZQRJGTKB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|