C11H14N4O5S — CID 78906305
ethyl 4-amino-2-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 78906305) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 78906305 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl 4-amino-2-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)NC(=O)OC)nc1N |
| InChI | InChI=1S/C11H14N4O5S/c1-3-20-9(17)6-4-13-10(15-8(6)12)21-5-7(16)14-11(18)19-2/h4H,3,5H2,1-2H3,(H2,12,13,15)(H,14,16,18) |
| InChIKey | WYZHVCYSLJABSU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |