C10H12BrN3O2S — CID 78968423
ethyl 4-amino-2-(2-bromoprop-2-enylsulfanyl)pyrimidine-5-carboxylate (PubChem CID 78968423) has the molecular formula C10H12BrN3O2S and a molecular weight of 318.20 g/mol. Its IUPAC name is ethyl 4-amino-2-(2-bromoprop-2-enylsulfanyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2-bromoprop-2-enylsulfanyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 78968423 |
| Molecular Formula | C10H12BrN3O2S |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | ethyl 4-amino-2-(2-bromoprop-2-enylsulfanyl)pyrimidine-5-carboxylate |
| SMILES | C=C(Br)CSc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C10H12BrN3O2S/c1-3-16-9(15)7-4-13-10(14-8(7)12)17-5-6(2)11/h4H,2-3,5H2,1H3,(H2,12,13,14) |
| InChIKey | ZUDGSBQROHOPHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |