C14H20N4O3S — CID 864483
ethyl 4-amino-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimidine-5-carboxylate (PubChem CID 864483) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is ethyl 4-amino-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 864483 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl 4-amino-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)N2CCCCC2)nc1N |
| InChI | InChI=1S/C14H20N4O3S/c1-2-21-13(20)10-8-16-14(17-12(10)15)22-9-11(19)18-6-4-3-5-7-18/h8H,2-7,9H2,1H3,(H2,15,16,17) |
| InChIKey | XWCSFXJBWLENAW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |