C21H32N4O3S — CID 1163095
ethyl 4-amino-2-[2-(dicyclohexylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 1163095) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(dicyclohexylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(dicyclohexylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1163095 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl 4-amino-2-[2-(dicyclohexylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)N(C2CCCCC2)C2CCCCC2)nc1N |
| InChI | InChI=1S/C21H32N4O3S/c1-2-28-20(27)17-13-23-21(24-19(17)22)29-14-18(26)25(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h13,15-16H,2-12,14H2,1H3,(H2,22,23,24) |
| InChIKey | SQIMFVAZMQWZBI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |