C10H13N5O4S — CID 78906339
ethyl 4-amino-2-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 78906339) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 78906339 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | ethyl 4-amino-2-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)NC(N)=O)nc1N |
| InChI | InChI=1S/C10H13N5O4S/c1-2-19-8(17)5-3-13-10(15-7(5)11)20-4-6(16)14-9(12)18/h3H,2,4H2,1H3,(H2,11,13,15)(H3,12,14,16,18) |
| InChIKey | CZICCBBGXURETD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |