C13H20N4O2S — CID 166220513
ethyl 4-amino-2-[(1-methylpyrrolidin-3-yl)methylsulfanyl]pyrimidine-5-carboxylate (PubChem CID 166220513) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is ethyl 4-amino-2-[(1-methylpyrrolidin-3-yl)methylsulfanyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(1-methylpyrrolidin-3-yl)methylsulfanyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166220513 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 4-amino-2-[(1-methylpyrrolidin-3-yl)methylsulfanyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC2CCN(C)C2)nc1N |
| InChI | InChI=1S/C13H20N4O2S/c1-3-19-12(18)10-6-15-13(16-11(10)14)20-8-9-4-5-17(2)7-9/h6,9H,3-5,7-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | UNKINBAGVMYIND-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |