C13H19N3O3S — CID 103134857
ethyl 4-amino-2-[(5-methyloxolan-2-yl)methylsulfanyl]pyrimidine-5-carboxylate (PubChem CID 103134857) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 4-amino-2-[(5-methyloxolan-2-yl)methylsulfanyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(5-methyloxolan-2-yl)methylsulfanyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 103134857 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 4-amino-2-[(5-methyloxolan-2-yl)methylsulfanyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC2CCC(C)O2)nc1N |
| InChI | InChI=1S/C13H19N3O3S/c1-3-18-12(17)10-6-15-13(16-11(10)14)20-7-9-5-4-8(2)19-9/h6,8-9H,3-5,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | XJNOAEJWOZKKLQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |