C11H13N3O4S — CID 42903098
ethyl 4-amino-2-(2-oxooxolan-3-yl)sulfanylpyrimidine-5-carboxylate (PubChem CID 42903098) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is ethyl 4-amino-2-(2-oxooxolan-3-yl)sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2-oxooxolan-3-yl)sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42903098 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | ethyl 4-amino-2-(2-oxooxolan-3-yl)sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC2CCOC2=O)nc1N |
| InChI | InChI=1S/C11H13N3O4S/c1-2-17-9(15)6-5-13-11(14-8(6)12)19-7-3-4-18-10(7)16/h5,7H,2-4H2,1H3,(H2,12,13,14) |
| InChIKey | ULJVUDLQKXDUDW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |