C11H17N3O3S — CID 78925728
ethyl 4-amino-2-(4-hydroxybutylsulfanyl)pyrimidine-5-carboxylate (PubChem CID 78925728) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 4-amino-2-(4-hydroxybutylsulfanyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(4-hydroxybutylsulfanyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 78925728 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl 4-amino-2-(4-hydroxybutylsulfanyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCCCCO)nc1N |
| InChI | InChI=1S/C11H17N3O3S/c1-2-17-10(16)8-7-13-11(14-9(8)12)18-6-4-3-5-15/h7,15H,2-6H2,1H3,(H2,12,13,14) |
| InChIKey | HAQFZLAMHDVYPD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|