C14H20N4O2S — CID 79489504
ethyl 4-amino-2-(4-cyano-4-methylpentyl)sulfanylpyrimidine-5-carboxylate (PubChem CID 79489504) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is ethyl 4-amino-2-(4-cyano-4-methylpentyl)sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(4-cyano-4-methylpentyl)sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 79489504 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 4-amino-2-(4-cyano-4-methylpentyl)sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCCCC(C)(C)C#N)nc1N |
| InChI | InChI=1S/C14H20N4O2S/c1-4-20-12(19)10-8-17-13(18-11(10)16)21-7-5-6-14(2,3)9-15/h8H,4-7H2,1-3H3,(H2,16,17,18) |
| InChIKey | OEHSYFLDJAONTI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|